2-Oxazolidinone, 5-(2,2-diMethyl-4H-1,3-benzodioxin-6-yl)-, (5R)-

pro_cas
452339-73-0
pro_cdbregno
CCD08297914
pro_formula
C13H15NO4
pro_molWeight
249.2625

basic_info

Product_Name: 2-Oxazolidinone, 5-(2,2-diMethyl-4H-1,3-benzodioxin-6-yl)-, (5R)-
CAS: 452339-73-0
EnglishSynonyms: 2-OXAZOLIDINONE, 5-(2,2-DIMETHYL-4H-1,3-BENZODIOXIN-6-YL)-, (5R)-
pro_acceptors: 0
pro_donors: 0
pro_smile: CC1(OCC2=C(O1)C=CC(=C2)[C@@H]2CNC(O2)=O)C
InChi: InChI=1S/C13H15NO4/c1-13(2)16-7-9-5-8(3-4-10(9)18-13)11-6-14-12(15)17-11/h3-5,11H,6-7H2,1-2H3,(H,14,15)/t11-/m0/s1
InChiKey: InChIKey=JUEBDVANOFZMMX-NSHDSACASA-N

property

secure_info