4-Oxo-3-(phenylMethoxy)-4H-pyran-2,5-dicarboxylic acid 2,5-diMethyl ester

pro_cas
1246616-66-9
pro_cdbregno
CCD08297920
pro_formula
C16H14O7
pro_molWeight
318.2782

basic_info

Product_Name: 4-Oxo-3-(phenylMethoxy)-4H-pyran-2,5-dicarboxylic acid 2,5-diMethyl ester
CAS: 1246616-66-9
EnglishSynonyms: 4-OXO-3-(PHENYLMETHOXY)-4H-PYRAN-2,5-DICARBOXYLIC ACID 2,5-DIMETHYL ESTER
pro_acceptors: 0
pro_donors: 0
pro_smile: COC(=O)C=1OC=C(C(C1OCC1=CC=CC=C1)=O)C(=O)OC
InChi: InChI=1S/C16H14O7/c1-20-15(18)11-9-23-14(16(19)21-2)13(12(11)17)22-8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
InChiKey: InChIKey=REVROVKRCYLCAT-UHFFFAOYSA-N

property

secure_info