4-oxotetradecanoic acid

pro_cas
107921-26-6
pro_cdbregno
CCD08298771
pro_formula
C14H26O3
pro_molWeight
242.3544

basic_info

Product_Name: 4-oxotetradecanoic acid
CAS: 107921-26-6
EnglishSynonyms: 4-OXOTETRADECANOIC ACID
pro_acceptors: 0
pro_donors: 0
pro_smile: O=C(CCC(=O)O)CCCCCCCCCC
InChi: InChI=1S/C14H26O3/c1-2-3-4-5-6-7-8-9-10-13(15)11-12-14(16)17/h2-12H2,1H3,(H,16,17)
InChiKey: InChIKey=OUVOKRXNCJSVKU-UHFFFAOYSA-N

property

secure_info