4-oxopentadecanoic acid

pro_cas
109788-69-4
pro_cdbregno
CCD08298772
pro_formula
C15H28O3
pro_molWeight
256.381

basic_info

Product_Name: 4-oxopentadecanoic acid
CAS: 109788-69-4
EnglishSynonyms: 4-OXOPENTADECANOIC ACID
pro_acceptors: 0
pro_donors: 0
pro_smile: O=C(CCC(=O)O)CCCCCCCCCCC
InChi: InChI=1S/C15H28O3/c1-2-3-4-5-6-7-8-9-10-11-14(16)12-13-15(17)18/h2-13H2,1H3,(H,17,18)
InChiKey: InChIKey=PFJKZQUXOYQRNT-UHFFFAOYSA-N

property

secure_info