2,4,6-trimethylphenyl carbonochloridate

pro_cas
7693-47-2
pro_cdbregno
CCD08299620
pro_formula
C10H11ClO2
pro_molWeight
198.646

basic_info

Product_Name: 2,4,6-trimethylphenyl carbonochloridate
CAS: 7693-47-2
EnglishSynonyms: 2,4,6-TRIMETHYLPHENYL CARBONOCHLORIDATE
pro_acceptors: 0
pro_donors: 0
pro_smile: C(OC1=C(C=C(C=C1C)C)C)(=O)Cl
InChi: InChI=1S/C10H11ClO2/c1-6-4-7(2)9(8(3)5-6)13-10(11)12/h4-5H,1-3H3
InChiKey: InChIKey=CPJUZSXZARKCIM-UHFFFAOYSA-N

property

secure_info