


Product_Name: [(2S,3R,4R,5R,6R)-6-(acetoxymethyl)-3-(isothiocyanato)tetrahydro-2H-pyran-2,4,5-triyl]triacetate
CAS: 1416573-63-1
pro_acceptors: 0
pro_donors: 0
pro_smile: C(C)(=O)OC[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)CC(=O)[O-])N=C=S)CC(=O)[O-])CC(=O)[O-]
InChi: InChI=1S/C15H19NO9S/c1-7(17)24-5-11-8(2-12(18)19)9(3-13(20)21)15(16-6-26)10(25-11)4-14(22)23/h8-11,15H,2-5H2,1H3,(H,18,19)(H,20,21)(H,22,23)/p-3/t8-,9-,10+,11+,15-/m1/s1

