4-chloro-3-isothiocyanato-1,5-naphthyridine

pro_cas
1421267-30-2
pro_cdbregno
CCD08299623
pro_formula
C9H4ClN3S
pro_molWeight
221.666

basic_info

Product_Name: 4-chloro-3-isothiocyanato-1,5-naphthyridine
CAS: 1421267-30-2
EnglishSynonyms: 4-CHLORO-3-ISOTHIOCYANATO-1,5-NAPHTHYRIDINE
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC1=C(C=NC2=CC=CN=C12)N=C=S
InChi: InChI=1S/C9H4ClN3S/c10-8-7(13-5-14)4-12-6-2-1-3-11-9(6)8/h1-4H
InChiKey: InChIKey=MHDJQRRXVKSDLL-UHFFFAOYSA-N

property

secure_info