3-(3-chlorophenyl)-6H-imidazo[5,1-b]thiazole-5-thione

pro_cas
1429312-34-4
pro_cdbregno
CCD08299624
pro_formula
C11H7ClN2S2
pro_molWeight
266.77

basic_info

Product_Name: 3-(3-chlorophenyl)-6H-imidazo[5,1-b]thiazole-5-thione
CAS: 1429312-34-4
EnglishSynonyms: 3-(3-CHLOROPHENYL)-6H-IMIDAZO[5,1-B]THIAZOLE-5-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC=1C=C(C=CC1)C=1N2C(SC1)=CNC2=S
InChi: InChI=1S/C11H7ClN2S2/c12-8-3-1-2-7(4-8)9-6-16-10-5-13-11(15)14(9)10/h1-6H,(H,13,15)
InChiKey: InChIKey=BVZHBMNBBRHDJM-UHFFFAOYSA-N

property

secure_info