ethyl 4-isothiocyanatothiophene-3-carboxylate

pro_cas
1356353-34-8
pro_cdbregno
CCD08299625
pro_formula
C8H7NO2S2
pro_molWeight
213.277

basic_info

Product_Name: ethyl 4-isothiocyanatothiophene-3-carboxylate
CAS: 1356353-34-8
EnglishSynonyms: ETHYL 4-ISOTHIOCYANATOTHIOPHENE-3-CARBOXYLATE
pro_acceptors: 0
pro_donors: 0
pro_smile: N(=C=S)C=1C(=CSC1)C(=O)OCC
InChi: InChI=1S/C8H7NO2S2/c1-2-11-8(10)6-3-13-4-7(6)9-5-12/h3-4H,2H2,1H3
InChiKey: InChIKey=SRXRMMCMRBMDNQ-UHFFFAOYSA-N

property

secure_info