2-diethylaminoethylisothiocyanate

pro_cas
32813-52-8
pro_cdbregno
CCD08299631
pro_formula
C7H14N2S
pro_molWeight
158.264

basic_info

Product_Name: 2-diethylaminoethylisothiocyanate
CAS: 32813-52-8
EnglishSynonyms: 2-DIETHYLAMINOETHYLISOTHIOCYANATE
pro_acceptors: 0
pro_donors: 0
pro_smile: C(C)N(CCN=C=S)CC
InChi: InChI=1S/C7H14N2S/c1-3-9(4-2)6-5-8-7-10/h3-6H2,1-2H3
InChiKey: InChIKey=LASJRIHCUCYPGY-UHFFFAOYSA-N

property

secure_info