4-isothiocyanatomethyl-benzonitrile

pro_cas
3694-48-2
pro_cdbregno
CCD08299632
pro_formula
C9H6N2S
pro_molWeight
174.222

basic_info

Product_Name: 4-isothiocyanatomethyl-benzonitrile
CAS: 3694-48-2
EnglishSynonyms: 4-ISOTHIOCYANATOMETHYL-BENZONITRILE
pro_acceptors: 0
pro_donors: 0
pro_smile: N(=C=S)CC1=CC=C(C#N)C=C1
InChi: InChI=1S/C9H6N2S/c10-5-8-1-3-9(4-2-8)6-11-7-12/h1-4H,6H2
InChiKey: InChIKey=TZQWCCPNIOIMFE-UHFFFAOYSA-N

property

secure_info