β-phenylpropyl isothiocyanate

pro_cas
76924-10-2
pro_cdbregno
CCD08299633
pro_formula
C10H11NS
pro_molWeight
177.266

basic_info

Product_Name: β-phenylpropyl isothiocyanate
CAS: 76924-10-2
EnglishSynonyms: Β-PHENYLPROPYL ISOTHIOCYANATE
pro_acceptors: 0
pro_donors: 0
pro_smile: C1(=CC=CC=C1)C(CN=C=S)C
InChi: InChI=1S/C10H11NS/c1-9(7-11-8-12)10-5-3-2-4-6-10/h2-6,9H,7H2,1H3
InChiKey: InChIKey=FGESWFIKOLPCKC-UHFFFAOYSA-N

property

secure_info