4-Cyclohexyl-2,6-diethyl-phenyl isothiocyanate

pro_cas
67330-36-3
pro_cdbregno
CCD08299636
pro_formula
C17H23NS
pro_molWeight
273.436

basic_info

Product_Name: 4-Cyclohexyl-2,6-diethyl-phenyl isothiocyanate
CAS: 67330-36-3
EnglishSynonyms: 4-CYCLOHEXYL-2,6-DIETHYL-PHENYL ISOTHIOCYANATE
pro_acceptors: 0
pro_donors: 0
pro_smile: C1(CCCCC1)C1=CC(=C(C(=C1)CC)N=C=S)CC
InChi: InChI=1S/C17H23NS/c1-3-13-10-16(15-8-6-5-7-9-15)11-14(4-2)17(13)18-12-19/h10-11,15H,3-9H2,1-2H3
InChiKey: InChIKey=JRALHBBVCMPPRY-UHFFFAOYSA-N

property

secure_info