6-methoxy-3,4-dihydro-(1H)-quinazoline-2-thione

pro_cas
736985-41-4
pro_cdbregno
CCD08299642
pro_formula
C9H10N2OS
pro_molWeight
194.253

basic_info

Product_Name: 6-methoxy-3,4-dihydro-(1H)-quinazoline-2-thione
CAS: 736985-41-4
EnglishSynonyms: 6-METHOXY-3,4-DIHYDRO-(1H)-QUINAZOLINE-2-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: COC=1C=C2CNC(NC2=CC1)=S
InChi: InChI=1S/C9H10N2OS/c1-12-7-2-3-8-6(4-7)5-10-9(13)11-8/h2-4H,5H2,1H3,(H2,10,11,13)
InChiKey: InChIKey=LHCGUXVKOLHUTJ-UHFFFAOYSA-N

property

secure_info