4(S)-(methoxycarbonyl)-N-benzyl-1,3-oxazolidine-2-thione

pro_cas
780558-36-3
pro_cdbregno
CCD08299643
pro_formula
C12H13NO3S
pro_molWeight
251.302

basic_info

Product_Name: 4(S)-(methoxycarbonyl)-N-benzyl-1,3-oxazolidine-2-thione
CAS: 780558-36-3
EnglishSynonyms: 4(S)-(METHOXYCARBONYL)-N-BENZYL-1,3-OXAZOLIDINE-2-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: COC(=O)[C@H]1N(C(OC1)=S)CC1=CC=CC=C1
InChi: InChI=1S/C12H13NO3S/c1-15-11(14)10-8-16-12(17)13(10)7-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3/t10-/m0/s1
InChiKey: InChIKey=WAFHPDJZBRXNRP-JTQLQIEISA-N

property

secure_info