3-benzyltetrahydro-1,3-oxazine-2-thione

pro_cas
700840-90-0
pro_cdbregno
CCD08299644
pro_formula
C11H13NOS
pro_molWeight
207.292

basic_info

Product_Name: 3-benzyltetrahydro-1,3-oxazine-2-thione
CAS: 700840-90-0
EnglishSynonyms: 3-BENZYLTETRAHYDRO-1,3-OXAZINE-2-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: C(C1=CC=CC=C1)N1C(OCCC1)=S
InChi: InChI=1S/C11H13NOS/c14-11-12(7-4-8-13-11)9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2
InChiKey: InChIKey=HDOFEGOHXGTLFY-UHFFFAOYSA-N

property

secure_info