(S)-2-isothiocyanato-N,N-diethyl-3,3-dimethylbutanamide

pro_cas
919113-08-9
pro_cdbregno
CCD08299646
pro_formula
C11H20N2OS
pro_molWeight
228.354

basic_info

Product_Name: (S)-2-isothiocyanato-N,N-diethyl-3,3-dimethylbutanamide
CAS: 919113-08-9
EnglishSynonyms: (S)-2-ISOTHIOCYANATO-N,N-DIETHYL-3,3-DIMETHYLBUTANAMIDE
pro_acceptors: 0
pro_donors: 0
pro_smile: N(=C=S)[C@H](C(=O)N(CC)CC)C(C)(C)C
InChi: InChI=1S/C11H20N2OS/c1-6-13(7-2)10(14)9(12-8-15)11(3,4)5/h9H,6-7H2,1-5H3/t9-/m1/s1
InChiKey: InChIKey=CDJCAKODSXWDRB-SECBINFHSA-N

property

secure_info