5-bromo-2-isothiocyanato-benzoic acid methyl ester

pro_cas
131842-27-8
pro_cdbregno
CCD08299647
pro_formula
C9H6BrNO2S
pro_molWeight
272.118

basic_info

Product_Name: 5-bromo-2-isothiocyanato-benzoic acid methyl ester
CAS: 131842-27-8
EnglishSynonyms: 5-BROMO-2-ISOTHIOCYANATO-BENZOIC ACID METHYL ESTER
pro_acceptors: 0
pro_donors: 0
pro_smile: COC(C1=C(C=CC(=C1)Br)N=C=S)=O
InChi: InChI=1S/C9H6BrNO2S/c1-13-9(12)7-4-6(10)2-3-8(7)11-5-14/h2-4H,1H3
InChiKey: InChIKey=BOVYMTDISMCWLI-UHFFFAOYSA-N

property

secure_info