5,5-diethyl-1,3-dioxane-2-thione

pro_cas
119543-65-6
pro_cdbregno
CCD08299649
pro_formula
C8H14O2S
pro_molWeight
174.261

basic_info

Product_Name: 5,5-diethyl-1,3-dioxane-2-thione
CAS: 119543-65-6
EnglishSynonyms: 5,5-DIETHYL-1,3-DIOXANE-2-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: C(C)C1(COC(OC1)=S)CC
InChi: InChI=1S/C8H14O2S/c1-3-8(4-2)5-9-7(11)10-6-8/h3-6H2,1-2H3
InChiKey: InChIKey=ZTBZWXPGUKSAHX-UHFFFAOYSA-N

property

secure_info