methyl 2-[2-(3-fluoro-4-isothiocyanatophenoxymethyl)-5-methylphenoxy]propionate

pro_cas
154080-21-4
pro_cdbregno
CCD08299650
pro_formula
C19H18FNO4S
pro_molWeight
375.414

basic_info

Product_Name: methyl 2-[2-(3-fluoro-4-isothiocyanatophenoxymethyl)-5-methylphenoxy]propionate
CAS: 154080-21-4
EnglishSynonyms: METHYL 2-[2-(3-FLUORO-4-ISOTHIOCYANATOPHENOXYMETHYL)-5-METHYLPHENOXY]PROPIONATE
pro_acceptors: 0
pro_donors: 0
pro_smile: FC=1C=C(OCC2=C(OC(C(=O)OC)C)C=C(C=C2)C)C=CC1N=C=S
InChi: InChI=1S/C19H18FNO4S/c1-12-4-5-14(18(8-12)25-13(2)19(22)23-3)10-24-15-6-7-17(21-11-26)16(20)9-15/h4-9,13H,10H2,1-3H3
InChiKey: InChIKey=MEPGPMJNAKKDID-UHFFFAOYSA-N

property

secure_info