4,5-bis(bromomethyl)-1,3-dioxolane-2-thione

pro_cas
1051374-80-1
pro_cdbregno
CCD08299652
pro_formula
C5H6Br2O2S
pro_molWeight
289.973

basic_info

Product_Name: 4,5-bis(bromomethyl)-1,3-dioxolane-2-thione
CAS: 1051374-80-1
EnglishSynonyms: 4,5-BIS(BROMOMETHYL)-1,3-DIOXOLANE-2-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: BrCC1OC(OC1CBr)=S
InChi: InChI=1S/C5H6Br2O2S/c6-1-3-4(2-7)9-5(10)8-3/h3-4H,1-2H2
InChiKey: InChIKey=FWPCYRCPYXMPSI-UHFFFAOYSA-N

property

secure_info