{5-[2-(2,6-dichloro-phenyl)-3H-benzoimidazol-5-yl]-[1,3,4]oxadiazol-2-yl}-quinolin-2-yl-amine

pro_cas
1137671-09-0
pro_cdbregno
CCD08299655
pro_formula
C24H14Cl2N6O
pro_molWeight
473.314

basic_info

Product_Name: {5-[2-(2,6-dichloro-phenyl)-3H-benzoimidazol-5-yl]-[1,3,4]oxadiazol-2-yl}-quinolin-2-yl-amine
CAS: 1137671-09-0
EnglishSynonyms: {5-[2-(2,6-DICHLORO-PHENYL)-3H-BENZOIMIDAZOL-5-YL]-[1,3,4]OXADIAZOL-2-YL}-QUINOLIN-2-YL-AMINE
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC1=C(C(=CC=C1)Cl)C=1NC2=C(N1)C=CC(=C2)C2=NN=C(O2)NC2=NC1=CC=CC=C1C=C2
InChi: InChI=1S/C24H14Cl2N6O/c25-15-5-3-6-16(26)21(15)22-28-18-10-8-14(12-19(18)29-22)23-31-32-24(33-23)30-20-11-9-13-4-1-2-7-17(13)27-20/h1-12H,(H,28,29)(H,27,30,32)
InChiKey: InChIKey=AOMKKMGSTLMMGD-UHFFFAOYSA-N

property

secure_info