


Product_Name: (5-chloro-pyridin-2-yl)-{5-[2-(2,6-dichloro-phenyl)-3H-benzoimidazol-5-yl]-[1,3,4]oxadiazol-2-yl}-amine
CAS: 1137671-08-9
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC=1C=CC(=NC1)NC=1OC(=NN1)C1=CC2=C(N=C(N2)C2=C(C=CC=C2Cl)Cl)C=C1
InChi: InChI=1S/C20H11Cl3N6O/c21-11-5-7-16(24-9-11)27-20-29-28-19(30-20)10-4-6-14-15(8-10)26-18(25-14)17-12(22)2-1-3-13(17)23/h1-9H,(H,25,26)(H,24,27,29)

