{5-[2-(2,6-dichloro-phenyl)-3H-benzoimidazol-5-yl]-[1,3,4]oxadiazol-2-yl}-(5-trifluoromethyl-pyridin-2-yl)-amine

pro_cas
1137671-03-4
pro_cdbregno
CCD08299658
pro_formula
C21H11Cl2F3N6O
pro_molWeight
491.253

basic_info

Product_Name: {5-[2-(2,6-dichloro-phenyl)-3H-benzoimidazol-5-yl]-[1,3,4]oxadiazol-2-yl}-(5-trifluoromethyl-pyridin-2-yl)-amine
CAS: 1137671-03-4
EnglishSynonyms: {5-[2-(2,6-DICHLORO-PHENYL)-3H-BENZOIMIDAZOL-5-YL]-[1,3,4]OXADIAZOL-2-YL}-(5-TRIFLUOROMETHYL-PYRIDIN-2-YL)-AMINE
pro_acceptors: 0
pro_donors: 0
pro_smile: ClC1=C(C(=CC=C1)Cl)C=1NC2=C(N1)C=CC(=C2)C2=NN=C(O2)NC2=NC=C(C=C2)C(F)(F)F
InChi: InChI=1S/C21H11Cl2F3N6O/c22-12-2-1-3-13(23)17(12)18-28-14-6-4-10(8-15(14)29-18)19-31-32-20(33-19)30-16-7-5-11(9-27-16)21(24,25)26/h1-9H,(H,28,29)(H,27,30,32)
InChiKey: InChIKey=WHPIFOJXIWHQAM-UHFFFAOYSA-N

property

secure_info