[1,3]dithiolo[4,5-f][1,10]phenanthroline-2-thione

pro_cas
1111633-15-8
pro_cdbregno
CCD08299659
pro_formula
C13H6N2S3
pro_molWeight
286.395

basic_info

Product_Name: [1,3]dithiolo[4,5-f][1,10]phenanthroline-2-thione
CAS: 1111633-15-8
EnglishSynonyms: [1,3]DITHIOLO[4,5-F][1,10]PHENANTHROLINE-2-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: S1C(SC2=C3C=CC=NC3=C3N=CC=CC3=C21)=S
InChi: InChI=1S/C13H6N2S3/c16-13-17-11-7-3-1-5-14-9(7)10-8(12(11)18-13)4-2-6-15-10/h1-6H
InChiKey: InChIKey=AHYKQBKSTOPQOY-UHFFFAOYSA-N

property

secure_info