4-vinyl-1,3-dioxolane-2-thione

pro_cas
1198600-65-5
pro_cdbregno
CCD08299661
pro_formula
C5H6O2S
pro_molWeight
130.165

basic_info

Product_Name: 4-vinyl-1,3-dioxolane-2-thione
CAS: 1198600-65-5
EnglishSynonyms: 4-VINYL-1,3-DIOXOLANE-2-THIONE
pro_acceptors: 0
pro_donors: 0
pro_smile: C(=C)C1OC(OC1)=S
InChi: InChI=1S/C5H6O2S/c1-2-4-3-6-5(8)7-4/h2,4H,1,3H2
InChiKey: InChIKey=VOBSQSDSVSATFQ-UHFFFAOYSA-N

property

secure_info