5-bromo-N-(2-fluoroethyl)-1H-benzo[d]imidazol-2-amine

pro_cas
1256958-93-6
pro_cdbregno
CCD08299663
pro_formula
C9H9BrFN3
pro_molWeight
258.09

basic_info

Product_Name: 5-bromo-N-(2-fluoroethyl)-1H-benzo[d]imidazol-2-amine
CAS: 1256958-93-6
EnglishSynonyms: 5-BROMO-N-(2-FLUOROETHYL)-1H-BENZO[D]IMIDAZOL-2-AMINE
pro_acceptors: 0
pro_donors: 0
pro_smile: BrC1=CC2=C(NC(=N2)NCCF)C=C1
InChi: InChI=1S/C9H9BrFN3/c10-6-1-2-7-8(5-6)14-9(13-7)12-4-3-11/h1-2,5H,3-4H2,(H2,12,13,14)
InChiKey: InChIKey=SAOMAXCMVQVGME-UHFFFAOYSA-N

property

secure_info