5-bromo-N-(2,2,2-trifluoroethyl)-1H-benzo[d]imidazol-2-amine

pro_cas
1256784-42-5
pro_cdbregno
CCD08299664
pro_formula
C9H7BrF3N3
pro_molWeight
294.071

basic_info

Product_Name: 5-bromo-N-(2,2,2-trifluoroethyl)-1H-benzo[d]imidazol-2-amine
CAS: 1256784-42-5
EnglishSynonyms: 5-BROMO-N-(2,2,2-TRIFLUOROETHYL)-1H-BENZO[D]IMIDAZOL-2-AMINE
pro_acceptors: 0
pro_donors: 0
pro_smile: BrC1=CC2=C(NC(=N2)NCC(F)(F)F)C=C1
InChi: InChI=1S/C9H7BrF3N3/c10-5-1-2-6-7(3-5)16-8(15-6)14-4-9(11,12)13/h1-3H,4H2,(H2,14,15,16)
InChiKey: InChIKey=OMJPHEOOSZFJPZ-UHFFFAOYSA-N

property

secure_info