


Product_Name: 3-[1-(4-fluoro-1,3-benzoxazol-2-yl)pyrrolidin-3-yl]-3-[4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-1H-pyrazol-1-yl]propanenitrile
CAS: 1257067-93-8
pro_acceptors: 0
pro_donors: 0
pro_smile: FC1=CC=CC2=C1N=C(O2)N2CC(CC2)C(CC#N)N2N=CC(=C2)C=2C1=C(N=CN2)NC=C1
InChi: InChI=1S/C23H19FN8O/c24-17-2-1-3-19-21(17)30-23(33-19)31-9-6-14(11-31)18(4-7-25)32-12-15(10-29-32)20-16-5-8-26-22(16)28-13-27-20/h1-3,5,8,10,12-14,18H,4,6,9,11H2,(H,26,27,28)

