Benzonitrile, 2-[(6-aminohexyl)oxy]-

pro_cas
1876877-42-7
pro_cdbregno
CCD08301447
pro_formula
C13H18N2O
pro_molWeight
218.2948

basic_info

Product_Name: Benzonitrile, 2-[(6-aminohexyl)oxy]-
CAS: 1876877-42-7
EnglishSynonyms: BENZONITRILE, 2-[(6-AMINOHEXYL)OXY]-
pro_acceptors: 0
pro_donors: 0
pro_smile: NCCCCCCOC1=C(C#N)C=CC=C1
InChi: InChI=1S/C13H18N2O/c14-9-5-1-2-6-10-16-13-8-4-3-7-12(13)11-15/h3-4,7-8H,1-2,5-6,9-10,14H2
InChiKey: InChIKey=MLDNEAOHRHYBPI-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.