1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-4-methyl-

pro_cas
244057-31-6
pro_cdbregno
CCD08301951
pro_formula
C14H12N2O4
pro_molWeight
272.2561

basic_info

Product_Name: 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-4-methyl-
CAS: 244057-31-6
EnglishSynonyms: 1H-ISOINDOLE-1,3(2H)-DIONE, 2-(2,6-DIOXO-3-PIPERIDINYL)-4-METHYL-
pro_acceptors: 0
pro_donors: 0
pro_smile: O=C1NC(CCC1N1C(C2=CC=CC(=C2C1=O)C)=O)=O
InChi: InChI=1S/C14H12N2O4/c1-7-3-2-4-8-11(7)14(20)16(13(8)19)9-5-6-10(17)15-12(9)18/h2-4,9H,5-6H2,1H3,(H,15,17,18)
InChiKey: InChIKey=PUEJOCVNXNAMGP-UHFFFAOYSA-N

property

secure_info

* If the product has intellectual property rights, a license granted is must or contact us.