(R)-1-(Benzylamino)-2-propanol

pro_cas
162240-94-0
pro_cdbregno
CCD08302642
pro_formula
C10H15NO
pro_molWeight
165.2322

basic_info

Product_Name: (R)-1-(Benzylamino)-2-propanol
CAS: 162240-94-0
EnglishSynonyms: (R)-1-(BENZYLAMINO)-2-PROPANOL
pro_acceptors: 0
pro_donors: 0
pro_smile: C(C1=CC=CC=C1)NC[C@@H](C)O
InChi: InChI=1S/C10H15NO/c1-9(12)7-11-8-10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/t9-/m1/s1
InChiKey: InChIKey=IVPPRWDCTCLFSP-SECBINFHSA-N

property

secure_info