


Product_Name: N2,N6-bis(4-aminophenyl)-2,6-Pyridinedicarboxamide
CAS: 1372048-27-5
pro_acceptors: 0
pro_donors: 0
pro_smile: NC1=CC=C(C=C1)NC(=O)C1=NC(=CC=C1)C(=O)NC1=CC=C(C=C1)N
InChi: InChI=1S/C19H17N5O2/c20-12-4-8-14(9-5-12)22-18(25)16-2-1-3-17(24-16)19(26)23-15-10-6-13(21)7-11-15/h1-11H,20-21H2,(H,22,25)(H,23,26)

