* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | LABOTEST-BB LT00451824 |
| EnglishSynonyms: | LABOTEST-BB LT00451824 ; OTAVA-BB 5008834 ; N-[(2E)-2-(HYDROXYIMINO)ETHYL]-2-PHENYLACETAMIDE ; TIMTEC-BB SBB057626 |
| pro_mdlNumber: | MFCD00002125 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | O\N=C\CNC(=O)CC1=CC=CC=C1 |
| InChi: | InChI=1S/C10H12N2O2/c13-10(11-6-7-12-14)8-9-4-2-1-3-5-9/h1-5,7,14H,6,8H2,(H,11,13)/b12-7+ |
| InChiKey: | InChIKey=ZAUBTQVVIVFNPC-KPKJPENVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.