* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AQ BC 9125 |
EnglishSynonyms: | RARECHEM AQ BC 9125 |
pro_mdlNumber: | MFCD00013277 |
pro_acceptors: | 10 |
pro_donors: | 2 |
pro_smile: | COC(=O)C1C2CC(C(C(=C2C(=O)OC)O)C(=O)OC)C(=C1O)C(=O)OC |
InChi: | InChI=1S/C17H20O10/c1-24-14(20)8-6-5-7(10(12(8)18)16(22)26-3)11(17(23)27-4)13(19)9(6)15(21)25-2/h6-8,11,18-19H,5H2,1-4H3 |
InChiKey: | InChIKey=POUJXYTVMNZVIK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.