* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM FH HF 0101 |
EnglishSynonyms: | RARECHEM FH HF 0101 |
pro_mdlNumber: | MFCD00024764 |
pro_acceptors: | 3 |
pro_donors: | 0 |
pro_smile: | c1ccc(cc1)C(c2ccccc2)c3ccc(cc3)[N+](=O)[O-] |
InChi: | InChI=1S/C19H15NO2/c21-20(22)18-13-11-17(12-14-18)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14,19H |
InChiKey: | InChIKey=PYIFQWWZCFQJQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.