* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9-OXO-15R-HYDROXY-PROSTA-10,13E-DIEN-1-OIC ACID |
| CAS: | 20897-92-1 |
| EnglishSynonyms: | 9-OXO-15R-HYDROXY-PROSTA-10,13E-DIEN-1-OIC ACID ; 15-EPI PROSTAGLANDIN A1 |
| pro_mdlNumber: | MFCD00036681 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | CCCCC[C@H](/C=C/[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)O)O |
| InChi: | InChI=1S/C20H32O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h12-18,21H,2-11H2,1H3,(H,23,24)/b14-12+/t16-,17+,18+/m0/s1 |
| InChiKey: | InChIKey=BGKHCLZFGPIKKU-AHUSATQRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.