* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | HIS-SER |
CAS: | 21438-60-8 |
EnglishSynonyms: | H-HIS-SER-OH ; HIS-SER |
pro_mdlNumber: | MFCD00037857 |
pro_acceptors: | 8 |
pro_donors: | 5 |
pro_smile: | c1c(nc[nH]1)C[C@@H](C(=O)N[C@@H](CO)C(=O)O)N |
InChi: | InChI=1S/C9H14N4O4/c10-6(1-5-2-11-4-12-5)8(15)13-7(3-14)9(16)17/h2,4,6-7,14H,1,3,10H2,(H,11,12)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
InChiKey: | InChIKey=KRBMQYPTDYSENE-BQBZGAKWSA-N |
property |
|
secure_info |
|
secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.