* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | 7-METHYL-3-OCTYNE |
CAS: | 37050-06-9 |
EnglishSynonyms: | 7-METHYLOCT-3-YNE ; 7-METHYL-3-OCTYNE |
pro_mdlNumber: | MFCD00041636 |
pro_acceptors: | 0 |
pro_donors: | 0 |
pro_smile: | CCC#CCCC(C)C |
InChi: | InChI=1S/C9H16/c1-4-5-6-7-8-9(2)3/h9H,4,7-8H2,1-3H3 |
InChiKey: | InChIKey=ZDXUMWBWHSCWBK-UHFFFAOYSA-N |
property |
|
Density: | DENSITY: 0.76 |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.