* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | L-ASPARTIC ACID, [14C(U)]- |
| CAS: | 52526-39-3 |
| EnglishSynonyms: | L-ASPARTIC ACID-UL-14C ; L-ASPARTIC ACID, [14C(U)]- ; L-ASPARAGINE-UL-14C ; ASPARTIC ACID, L-[14-C(U)] |
| pro_mdlNumber: | MFCD00055776 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | [14CH2]([14C@@H]([14C](=O)O)N)[14C](=O)O |
| InChi: | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i1+2,2+2,3+2,4+2 |
| InChiKey: | InChIKey=CKLJMWTZIZZHCS-BGTGBAJNSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.