* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | Z-PHE-ARG-4M-BETANA HCL |
| CAS: | 100900-17-2 |
| EnglishSynonyms: | Z-PHE-ARG-4M-BETANA HCL ; Z-PHE-ARG-4MBNA HCL |
| pro_mdlNumber: | MFCD00058035 |
| pro_acceptors: | 11 |
| pro_donors: | 6 |
| pro_smile: | COc1cc(cc2c1cccc2)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@H](Cc3ccccc3)NC(=O)OCc4ccccc4.Cl |
| InChi: | InChI=1S/C34H38N6O5.ClH/c1-44-30-21-26(20-25-15-8-9-16-27(25)30)38-31(41)28(17-10-18-37-33(35)36)39-32(42)29(19-23-11-4-2-5-12-23)40-34(43)45-22-24-13-6-3-7-14-24;/h2-9,11-16,20-21,28-29H,10,17-19,22H2,1H3,(H,38,41)(H,39,42)(H,40,43)(H4,35,36,37);1H/t28-,29-;/m0./s1 |
| InChiKey: | InChIKey=JSWXXBITNPRPEN-OCPPCWRMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.