* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 8(S),15(S)-DIHETE |
| CAS: | 80234-65-7 |
| EnglishSynonyms: | 8(S),15(S)-DIHETE (Z, E, Z, E) ; (8S,15S)-DIHYDROXY-(5Z,9E,11Z,13E)-EICOSATETRAENOIC ACID ; 8(S),15(S)-DIHETE |
| pro_mdlNumber: | MFCD00063587 |
| pro_acceptors: | 4 |
| pro_donors: | 3 |
| pro_smile: | CCCCC[C@@H](/C=C/C=C\C=C\[C@H](C/C=C\CCCC(=O)O)O)O |
| InChi: | InChI=1S/C20H32O4/c1-2-3-8-13-18(21)14-9-4-5-10-15-19(22)16-11-6-7-12-17-20(23)24/h4-6,9-11,14-15,18-19,21-22H,2-3,7-8,12-13,16-17H2,1H3,(H,23,24)/b5-4-,11-6-,14-9+,15-10+/t18-,19+/m0/s1 |
| InChiKey: | InChIKey=NNPWRKSGORGTIM-HCCKYKKOSA-N |
|
|
| Concentration: | ~75μg/mLinethanol |
|
|
| secure_damage_code: | F,Xi |
| secure_risk_disclosure_stmt: | R:11-36/37/38 |
| secure_security_stmt: | S:16-26-36 |
| secure_wgk_germany: | 1 |
* If the product has intellectual property rights, a license granted is must or contact us.