* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AX KI 0033 |
| EnglishSynonyms: | RARECHEM AX KI 0033 |
| pro_mdlNumber: | MFCD00063842 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CC[C@H](C(=O)O)N |
| InChi: | InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m1/s1 |
| InChiKey: | InChIKey=QWCKQJZIFLGMSD-GSVOUGTGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.