* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ORSEILLIN BB |
| CAS: | 5432-31-5 |
| EnglishSynonyms: | ORSEILLIN BB ; ORSEILLINE BB |
| pro_mdlNumber: | MFCD00068450 |
| pro_acceptors: | 11 |
| pro_donors: | 1 |
| pro_smile: | Cc1cc(ccc1/N=N/c2cc(c3ccccc3c2O)S(=O)(=O)[O-])/N=N/c4ccc(cc4C)S(=O)(=O)[O-].[Na+].[Na+] |
| InChi: | InChI=1S/C24H20N4O7S2.2Na/c1-14-11-16(25-26-21-10-8-17(12-15(21)2)36(30,31)32)7-9-20(14)27-28-22-13-23(37(33,34)35)18-5-3-4-6-19(18)24(22)29;;/h3-13,29H,1-2H3,(H,30,31,32)(H,33,34,35);;/q;2*+1/p-2/b26-25+,28-27+;; |
| InChiKey: | InChIKey=ARGFWAXVCJXLFX-NPYGFOBASA-L |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.