* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL BE 0936 |
EnglishSynonyms: | RARECHEM AL BE 0936 |
pro_mdlNumber: | MFCD00075687 |
pro_acceptors: | 7 |
pro_donors: | 1 |
pro_smile: | COc1cc(ccc1OCc2ccc(cc2)[N+](=O)[O-])C(=O)O |
InChi: | InChI=1S/C15H13NO6/c1-21-14-8-11(15(17)18)4-7-13(14)22-9-10-2-5-12(6-3-10)16(19)20/h2-8H,9H2,1H3,(H,17,18) |
InChiKey: | InChIKey=YMONHLJJRRITER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.