* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | CROTYL ACRYLATE |
CAS: | 23916-33-8 |
EnglishSynonyms: | CROTYL ACRYLATE ; (2E)-BUT-2-EN-1-YL PROP-2-ENOATE |
pro_mdlNumber: | MFCD00078413 |
pro_acceptors: | 2 |
pro_donors: | 0 |
pro_smile: | C/C=C/COC(=O)C=C |
InChi: | InChI=1S/C7H10O2/c1-3-5-6-9-7(8)4-2/h3-5H,2,6H2,1H3/b5-3+ |
InChiKey: | InChIKey=COXYCFKHVQFUPA-HWKANZROSA-N |
property |
|
Boiling_Point: | BP 72 (3MM) |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.