* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DIALLYL SEBACATE |
| CAS: | 3137-00-6 |
| EnglishSynonyms: | DIALLYL SEBACATE |
| pro_mdlNumber: | MFCD00080463 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | C=CCOC(=O)CCCCCCCCC(=O)OCC=C |
| InChi: | InChI=1S/C16H26O4/c1-3-13-19-15(17)11-9-7-5-6-8-10-12-16(18)20-14-4-2/h3-4H,1-2,5-14H2 |
| InChiKey: | InChIKey=NUVBFTZPEYQYGI-UHFFFAOYSA-N |
|
|
| Boiling_Point: | BP 79-80 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.