* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | L-ALANINE-2,3-13C2 |
EnglishSynonyms: | L-ALANINE-2,3-13C2 |
pro_mdlNumber: | MFCD00083879 |
pro_acceptors: | 3 |
pro_donors: | 2 |
pro_smile: | [13CH3][13C@@H](C(=O)O)N |
InChi: | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1/i1+1,2+1 |
InChiKey: | InChIKey=QNAYBMKLOCPYGJ-GSPFBODJSA-N |
property |
|
MeltingPoint: | 314.5 DEG C (DEC)(LIT) |
Comments: | MASS SHIFT: M+2 OPTICAL ACTIVITY: [ALPHA]25/D +14.5 DEG, C = 2 IN 1 M HCL WGK: 3 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 91.06 BY ATOM % CALCULATION |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.