* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | L-ASPARTIC ACID-2-13C |
| EnglishSynonyms: | L-ASPARTIC ACID-2-13C |
| pro_mdlNumber: | MFCD00083889 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | C([13C@@H](C(=O)O)N)C(=O)O |
| InChi: | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i2+1 |
| InChiKey: | InChIKey=CKLJMWTZIZZHCS-JACJRKFSSA-N |
|
|
| MeltingPoint: | >300 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]25/D +25.0 DEG, C = 2 IN 5 M HCL WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 134.09 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.