* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | IODOACETIC ACID (2-13C) |
| CAS: | 55757-50-1 |
| EnglishSynonyms: | IODOACETIC ACID (2-13C) |
| pro_mdlNumber: | MFCD00083994 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | [13CH2](C(=O)O)I |
| InChi: | InChI=1S/C2H3IO2/c3-1-2(4)5/h1H2,(H,4,5)/i1+1 |
| InChiKey: | InChIKey=JDNTWHVOXJZDSN-OUBTZVSYSA-N |
|
|
| MeltingPoint: | 77-79 DEG C(LIT) |
| Comments: | MASS SHIFT: M+1 RIDADR: UN 2923 8/PG 1 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 186.93 BY ATOM % CALCULATION |
|
|
| secure_symbol: |
GHS05
GHS06
|
| secure_signal_word: | Danger |
| secure_risk_stmt: | H301-H314 |
| secure_cautionary_stmt: | P280-P301 + P310-P305 + P351 + P338-P310 |
| secure_damage_code: | T,C |
| secure_risk_disclosure_stmt: | R:25-35 |
| secure_security_stmt: | S:22-36/37/39-45 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.